Difference between revisions of "L-Cysteine-Desulfurases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3723 == * common-name: ** uridine 2'-monophosphate * smiles: ** c(o)c1(oc(c(op(=o)([o-])[o-])c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite B-ALANINE == * common-name: ** β-alanine * smiles: ** c(c[n+])c([o-])=o * inchi-key: ** ucmirnveixfbks-uhfffaoysa-n * molecular-weig...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite B-ALANINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-alanine |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(c[n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ucmirnveixfbks-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 89.094 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PANTOATE-BETA-ALANINE-LIG-RXN]] | ||
| + | * [[RXN-2901]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[BETA-UREIDOPROPIONASE-RXN]] |
| + | * [[RXN-2901]] | ||
| + | * [[RXN-6382]] | ||
| + | * [[X-METHYL-HIS-DIPEPTIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-alanine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ucmirnveixfbks-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=89.094}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite B-ALANINE
- common-name:
- β-alanine
- smiles:
- c(c[n+])c([o-])=o
- inchi-key:
- ucmirnveixfbks-uhfffaoysa-n
- molecular-weight:
- 89.094
