Difference between revisions of "L-DEHYDRO-ASCORBATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06200 == * transcription-direction: ** positive * right-end-position: ** 132946 * left-end-position: ** 121378 * centisome-position: ** 25.290245...")
(Created page with "Category:metabolite == Metabolite L-DEHYDRO-ASCORBATE == * common-name: ** l-dehydro-ascorbate * smiles: ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) * inchi-key: ** sbjkkffyizucet-sz...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06200 ==
+
== Metabolite L-DEHYDRO-ASCORBATE ==
* transcription-direction:
+
* common-name:
** positive
+
** l-dehydro-ascorbate
* right-end-position:
+
* smiles:
** 132946
+
** c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
* left-end-position:
+
* inchi-key:
** 121378
+
** sbjkkffyizucet-szscbosdsa-n
* centisome-position:
+
* molecular-weight:
** 25.290245   
+
** 174.11
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[1.8.5.1-RXN]]
== Reaction(s) associated ==
+
* [[RXN-13185]]
* [[3.4.21.26-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[orthology]]
+
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[ETHYL-RXN]]
* [[3.4.21.83-RXN]]
+
* [[RXN-12440]]
** Category: [[annotation]]
+
* [[RXN-13185]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-19200]]
{{#set: transcription-direction=positive}}
+
* [[RXN-7984]]
{{#set: right-end-position=132946}}
+
* [[RXN-7985]]
{{#set: left-end-position=121378}}
+
== Reaction(s) of unknown directionality ==
{{#set: centisome-position=25.290245    }}
+
{{#set: common-name=l-dehydro-ascorbate}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: inchi-key=inchikey=sbjkkffyizucet-szscbosdsa-n}}
{{#set: nb reaction associated=2}}
+
{{#set: molecular-weight=174.11}}

Latest revision as of 11:12, 18 March 2021

Metabolite L-DEHYDRO-ASCORBATE

  • common-name:
    • l-dehydro-ascorbate
  • smiles:
    • c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
  • inchi-key:
    • sbjkkffyizucet-szscbosdsa-n
  • molecular-weight:
    • 174.11

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality