Difference between revisions of "L-DIHYDROXY-PHENYLALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1905 == * common-name: ** 8-oxo-dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=...")
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-ETHANOLAMINE == * common-name: ** o-phosphoethanolamine * smiles: ** c(c[n+])op([o-])([o-])=o * inchi-key: ** suhootkupisobe-u...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1905 ==
+
== Metabolite PHOSPHORYL-ETHANOLAMINE ==
 
* common-name:
 
* common-name:
** 8-oxo-dgtp
+
** o-phosphoethanolamine
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
+
** c(c[n+])op([o-])([o-])=o
 
* inchi-key:
 
* inchi-key:
** buzogvvqwcxxdp-vpeninkcsa-j
+
** suhootkupisobe-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 519.151
+
** 140.055
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11396]]
+
* [[2.7.7.14-RXN]]
* [[RXN-14205]]
+
* [[RXN-7948]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14205]]
+
* [[ETHANOLAMINE-KINASE-RXN]]
 +
* [[RXN-13729]]
 +
* [[RXN3DJ-11230]]
 +
* [[SGPL11]]
 +
* [[SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8-oxo-dgtp}}
+
{{#set: common-name=o-phosphoethanolamine}}
{{#set: inchi-key=inchikey=buzogvvqwcxxdp-vpeninkcsa-j}}
+
{{#set: inchi-key=inchikey=suhootkupisobe-uhfffaoysa-m}}
{{#set: molecular-weight=519.151}}
+
{{#set: molecular-weight=140.055}}

Revision as of 08:31, 15 March 2021

Metabolite PHOSPHORYL-ETHANOLAMINE

  • common-name:
    • o-phosphoethanolamine
  • smiles:
    • c(c[n+])op([o-])([o-])=o
  • inchi-key:
    • suhootkupisobe-uhfffaoysa-m
  • molecular-weight:
    • 140.055

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality