Difference between revisions of "L-DIHYDROXY-PHENYLALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13695 == * common-name: ** 3,24-dioxocholest-4-en-26-oyl-coa * smiles: ** cc(ccc(=o)c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)...")
(Created page with "Category:metabolite == Metabolite L-DIHYDROXY-PHENYLALANINE == * common-name: ** l-dopa * smiles: ** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-] * inchi-key: ** wtdrdqbearuvnc-...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13695 ==
+
== Metabolite L-DIHYDROXY-PHENYLALANINE ==
 
* common-name:
 
* common-name:
** 3,24-dioxocholest-4-en-26-oyl-coa
+
** l-dopa
 
* smiles:
 
* smiles:
** cc(ccc(=o)c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c)[ch]6(cc[ch]7([ch]5(ccc4(=cc(=o)ccc(c)4[ch]5ccc(c)67))))
+
** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** zvfuugbgzmbuan-kznrqmkssa-j
+
** wtdrdqbearuvnc-lurjtmiesa-n
 
* molecular-weight:
 
* molecular-weight:
** 1174.098
+
** 197.19
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13061]]
 +
* [[RXN-8460]]
 +
* [[RXN66-221]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12705]]
+
* [[RXN-5861]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,24-dioxocholest-4-en-26-oyl-coa}}
+
{{#set: common-name=l-dopa}}
{{#set: inchi-key=inchikey=zvfuugbgzmbuan-kznrqmkssa-j}}
+
{{#set: inchi-key=inchikey=wtdrdqbearuvnc-lurjtmiesa-n}}
{{#set: molecular-weight=1174.098}}
+
{{#set: molecular-weight=197.19}}

Latest revision as of 11:17, 18 March 2021

Metabolite L-DIHYDROXY-PHENYLALANINE

  • common-name:
    • l-dopa
  • smiles:
    • c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
  • inchi-key:
    • wtdrdqbearuvnc-lurjtmiesa-n
  • molecular-weight:
    • 197.19

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality