Difference between revisions of "L-DIHYDROXY-PHENYLALANINE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-9780 RXN3O-9780] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/E...") |
(Created page with "Category:metabolite == Metabolite L-DIHYDROXY-PHENYLALANINE == * common-name: ** l-dopa * smiles: ** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-] * inchi-key: ** wtdrdqbearuvnc-...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-DIHYDROXY-PHENYLALANINE == |
− | * | + | * common-name: |
− | ** | + | ** l-dopa |
− | * | + | * smiles: |
− | ** | + | ** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-] |
− | == | + | * inchi-key: |
− | + | ** wtdrdqbearuvnc-lurjtmiesa-n | |
− | + | * molecular-weight: | |
− | = | + | ** 197.19 |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN-13061]] |
− | * | + | * [[RXN-8460]] |
− | ** | + | * [[RXN66-221]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[RXN-5861]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=l-dopa}} | |
− | + | {{#set: inchi-key=inchikey=wtdrdqbearuvnc-lurjtmiesa-n}} | |
− | + | {{#set: molecular-weight=197.19}} | |
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite L-DIHYDROXY-PHENYLALANINE
- common-name:
- l-dopa
- smiles:
- c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
- inchi-key:
- wtdrdqbearuvnc-lurjtmiesa-n
- molecular-weight:
- 197.19