Difference between revisions of "L-DIHYDROXY-PHENYLALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-9780 RXN3O-9780] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/E...")
 
(Created page with "Category:metabolite == Metabolite L-DIHYDROXY-PHENYLALANINE == * common-name: ** l-dopa * smiles: ** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-] * inchi-key: ** wtdrdqbearuvnc-...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-9780 RXN3O-9780] ==
+
== Metabolite L-DIHYDROXY-PHENYLALANINE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** l-dopa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1 ec-2.3.1]
+
** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CO-A]][c] '''+''' 1 [[Palmitoyl-ACPs]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[PALMITYL-COA]][c]
+
** wtdrdqbearuvnc-lurjtmiesa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
== Pathway(s) ==
+
** 197.19
−
* [[PWY-7746]], mycobacterial sulfolipid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7746 PWY-7746]
+
== Reaction(s) known to consume the compound ==
−
** '''2''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN-13061]]
−
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
* [[RXN-8460]]
−
** '''31''' reactions found over '''31''' reactions in the full pathway
+
* [[RXN66-221]]
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_medium]]; tool: [[meneco]]; comment: added for gapfilling
+
* [[RXN-5861]]
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=left-to-right}}
+
{{#set: common-name=l-dopa}}
−
{{#set: ec-number=ec-2.3.1}}
+
{{#set: inchi-key=inchikey=wtdrdqbearuvnc-lurjtmiesa-n}}
−
{{#set: nb gene associated=0}}
+
{{#set: molecular-weight=197.19}}
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=gap-filling}}
 
−
{{#set: reconstruction tool=meneco}}
 
−
{{#set: reconstruction comment=added for gapfilling}}
 
−
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_medium}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite L-DIHYDROXY-PHENYLALANINE

  • common-name:
    • l-dopa
  • smiles:
    • c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
  • inchi-key:
    • wtdrdqbearuvnc-lurjtmiesa-n
  • molecular-weight:
    • 197.19

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-DIHYDROXY-PHENYLALANINE&oldid=139726"