Difference between revisions of "L-DIHYDROXY-PHENYLALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11268 RXN-11268] == * direction: ** left-to-right * common-name: ** s-adenosylmethionine: halid...")
(Created page with "Category:metabolite == Metabolite L-DIHYDROXY-PHENYLALANINE == * common-name: ** l-dopa * smiles: ** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-] * inchi-key: ** wtdrdqbearuvnc-...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11268 RXN-11268] ==
+
== Metabolite L-DIHYDROXY-PHENYLALANINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** s-adenosylmethionine: halide ion methyltransferase
+
** l-dopa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.165 ec-2.1.1.165]
+
** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[BR-]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-12221]][c]
+
** wtdrdqbearuvnc-lurjtmiesa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09773]]
+
** 197.19
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-13061]]
−
== Pathway(s) ==
+
* [[RXN-8460]]
−
* [[PWY-6730]], methylhalides biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6730 PWY-6730]
+
* [[RXN66-221]]
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[RXN-5861]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=l-dopa}}
−
* RHEA:
+
{{#set: inchi-key=inchikey=wtdrdqbearuvnc-lurjtmiesa-n}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27365 27365]
+
{{#set: molecular-weight=197.19}}
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=s-adenosylmethionine: halide ion methyltransferase}}
 
−
{{#set: ec-number=ec-2.1.1.165}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite L-DIHYDROXY-PHENYLALANINE

  • common-name:
    • l-dopa
  • smiles:
    • c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
  • inchi-key:
    • wtdrdqbearuvnc-lurjtmiesa-n
  • molecular-weight:
    • 197.19

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-DIHYDROXY-PHENYLALANINE&oldid=139726"