Difference between revisions of "L-EPINEPHRINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14950 == * common-name: ** 3-o-methylkaempferol * smiles: ** coc3(c(=o)c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(o)=cc=2))=3)) * inchi-key: ** v...")
(Created page with "Category:metabolite == Metabolite CPD-18 == * common-name: ** linoleoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14950 ==
+
== Metabolite CPD-18 ==
 
* common-name:
 
* common-name:
** 3-o-methylkaempferol
+
** linoleoyl-coa
 
* smiles:
 
* smiles:
** coc3(c(=o)c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(o)=cc=2))=3))
+
** cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** vjjzjbucdwkplc-uhfffaoysa-n
+
** yecllimzhnyfck-rrnjgntnsa-j
 
* molecular-weight:
 
* molecular-weight:
** 300.267
+
** 1025.937
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.14.19.3-RXN]]
 +
* [[FACOAE182]]
 +
* [[LINOLEOYL-RXN]]
 +
* [[RXN-16094]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13935]]
+
* [[LNLCCOAL]]
 +
* [[RXN-16045]]
 +
* [[RXN-9601]]
 +
* [[RXN-9673]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-o-methylkaempferol}}
+
{{#set: common-name=linoleoyl-coa}}
{{#set: inchi-key=inchikey=vjjzjbucdwkplc-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=yecllimzhnyfck-rrnjgntnsa-j}}
{{#set: molecular-weight=300.267}}
+
{{#set: molecular-weight=1025.937}}

Revision as of 14:58, 5 January 2021

Metabolite CPD-18

  • common-name:
    • linoleoyl-coa
  • smiles:
    • cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • yecllimzhnyfck-rrnjgntnsa-j
  • molecular-weight:
    • 1025.937

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality