Difference between revisions of "L-GAMMA-GLUTAMYLCYSTEINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-stearidonoyl-2-acyl-glycerolipids == * common-name: ** a 1-stearidonoyl 2-acyl-[glycerolipid] == Reaction(s) known to consume the compo...") |
(Created page with "Category:metabolite == Metabolite CPD-7526 == * common-name: ** 9,9'-di-cis-ζ-carotene * smiles: ** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7526 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 9,9'-di-cis-ζ-carotene |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** biwlelkafxrpde-zurblsrnsa-n | ||
| + | * molecular-weight: | ||
| + | ** 540.914 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11354]] |
| + | * [[RXN-11356]] | ||
| + | * [[RXN-12242]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11354]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=9,9'-di-cis-ζ-carotene}} |
| + | {{#set: inchi-key=inchikey=biwlelkafxrpde-zurblsrnsa-n}} | ||
| + | {{#set: molecular-weight=540.914}} | ||
Revision as of 08:29, 15 March 2021
Contents
Metabolite CPD-7526
- common-name:
- 9,9'-di-cis-ζ-carotene
- smiles:
- cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
- inchi-key:
- biwlelkafxrpde-zurblsrnsa-n
- molecular-weight:
- 540.914
