Difference between revisions of "L-GAMMA-GLUTAMYLCYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7526 == * common-name: ** 9,9'-di-cis-ζ-carotene * smiles: ** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)...")
(Created page with "Category:metabolite == Metabolite L-GAMMA-GLUTAMYLCYSTEINE == * common-name: ** γ-l-glutamyl-l-cysteine * smiles: ** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o * inchi...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7526 ==
+
== Metabolite L-GAMMA-GLUTAMYLCYSTEINE ==
 
* common-name:
 
* common-name:
** 9,9'-di-cis-ζ-carotene
+
** γ-l-glutamyl-l-cysteine
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
+
** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** biwlelkafxrpde-zurblsrnsa-n
+
** ritkhvbhsgluln-whfbiakzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 540.914
+
** 249.261
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11354]]
+
* [[GLUTATHIONE-SYN-RXN]]
* [[RXN-11356]]
+
* [[RXN-14430]]
* [[RXN-12242]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11354]]
+
* [[GLUTCYSLIG-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=9,9'-di-cis-ζ-carotene}}
+
{{#set: common-name=γ-l-glutamyl-l-cysteine}}
{{#set: inchi-key=inchikey=biwlelkafxrpde-zurblsrnsa-n}}
+
{{#set: inchi-key=inchikey=ritkhvbhsgluln-whfbiakzsa-m}}
{{#set: molecular-weight=540.914}}
+
{{#set: molecular-weight=249.261}}

Latest revision as of 11:16, 18 March 2021

Metabolite L-GAMMA-GLUTAMYLCYSTEINE

  • common-name:
    • γ-l-glutamyl-l-cysteine
  • smiles:
    • c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • ritkhvbhsgluln-whfbiakzsa-m
  • molecular-weight:
    • 249.261

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality