Difference between revisions of "L-GAMMA-GLUTAMYLCYSTEINE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11698 RXN-11698] == * direction: ** left-to-right * common-name: ** prenyl protein-specific end...") |
(Created page with "Category:metabolite == Metabolite L-GAMMA-GLUTAMYLCYSTEINE == * common-name: ** γ-l-glutamyl-l-cysteine * smiles: ** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o * inchi...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-GAMMA-GLUTAMYLCYSTEINE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** γ-l-glutamyl-l-cysteine |
− | * | + | * smiles: |
− | ** [ | + | ** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o |
− | == | + | * inchi-key: |
− | + | ** ritkhvbhsgluln-whfbiakzsa-m | |
− | == | + | * molecular-weight: |
− | * | + | ** 249.261 |
− | * | + | == Reaction(s) known to consume the compound == |
− | + | * [[GLUTATHIONE-SYN-RXN]] | |
− | == | + | * [[RXN-14430]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[GLUTCYSLIG-RXN]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=γ-l-glutamyl-l-cysteine}} | |
− | {{#set: common-name= | + | {{#set: inchi-key=inchikey=ritkhvbhsgluln-whfbiakzsa-m}} |
− | + | {{#set: molecular-weight=249.261}} | |
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite L-GAMMA-GLUTAMYLCYSTEINE
- common-name:
- γ-l-glutamyl-l-cysteine
- smiles:
- c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o
- inchi-key:
- ritkhvbhsgluln-whfbiakzsa-m
- molecular-weight:
- 249.261