Difference between revisions of "L-GAMMA-GLUTAMYLCYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCOPHOSPHORYL-RXN GLYCOPHOSPHORYL-RXN] == * direction: ** left-to-right * common-name: ** phospho...")
 
(Created page with "Category:metabolite == Metabolite L-GAMMA-GLUTAMYLCYSTEINE == * common-name: ** γ-l-glutamyl-l-cysteine * smiles: ** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o * inchi...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCOPHOSPHORYL-RXN GLYCOPHOSPHORYL-RXN] ==
+
== Metabolite L-GAMMA-GLUTAMYLCYSTEINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** phosphorylase
+
** γ-l-glutamyl-l-cysteine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.1.1 ec-2.4.1.1]
+
** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Glycogens]][c] '''+''' 1 [[Pi]][c] '''=>''' 1 [[CPD0-971]][c] '''+''' 1 [[GLC-1-P]][c]
+
** ritkhvbhsgluln-whfbiakzsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ18078]]
+
** 249.261
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[GLUTATHIONE-SYN-RXN]]
−
== Pathway(s) ==
+
* [[RXN-14430]]
−
* [[PWY-5941]], glycogen degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5941 PWY-5941]
+
== Reaction(s) known to produce the compound ==
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
* [[GLUTCYSLIG-RXN]]
−
* [[GLYCOCAT-PWY]], glycogen degradation I: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOCAT-PWY GLYCOCAT-PWY]
+
== Reaction(s) of unknown directionality ==
−
** '''6''' reactions found over '''8''' reactions in the full pathway
+
{{#set: common-name=γ-l-glutamyl-l-cysteine}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=ritkhvbhsgluln-whfbiakzsa-m}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=249.261}}
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=phosphorylase}}
 
−
{{#set: ec-number=ec-2.4.1.1}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite L-GAMMA-GLUTAMYLCYSTEINE

  • common-name:
    • γ-l-glutamyl-l-cysteine
  • smiles:
    • c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • ritkhvbhsgluln-whfbiakzsa-m
  • molecular-weight:
    • 249.261

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-GAMMA-GLUTAMYLCYSTEINE&oldid=138941"