Difference between revisions of "L-GAMMA-GLUTAMYLCYSTEINE"

Revision as of 18:57, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-696 ==
+== Metabolite DPG ==
 * common-name:
-** 24-methylenecycloartanol
+** 3-phospho-d-glyceroyl-phosphate
 * smiles:
-** cc(c)c(=c)ccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5))))
+** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-]
 * inchi-key:
-** bdhqmrxfdyjgii-xpnryqhysa-n
+** ljqlqcaxbuheaz-uwtatzphsa-j
 * molecular-weight:
-** 440.751
+** 262.006
 == Reaction(s) known to consume the compound ==
+* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
+* [[GAPDHSYNEC-RXN]]
+* [[GAPDH_]]
+* [[GAPOXNPHOSPHN-RXN]]
+* [[PHOSGLYPHOS-RXN]]
+* [[RXN-17274]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-4021]]
+* [[GAPDHSYNEC-RXN]]
+* [[GAPDH_]]
+* [[GAPOXNPHOSPHN-RXN]]
+* [[PHOSGLYPHOS-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=24-methylenecycloartanol}}
+{{#set: common-name=3-phospho-d-glyceroyl-phosphate}}
-{{#set: inchi-key=inchikey=bdhqmrxfdyjgii-xpnryqhysa-n}}
+{{#set: inchi-key=inchikey=ljqlqcaxbuheaz-uwtatzphsa-j}}
-{{#set: molecular-weight=440.751}}
+{{#set: molecular-weight=262.006}}