|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2601 RXN0-2601] == | + | == Metabolite L-GAMMA-GLUTAMYLCYSTEINE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** dna-(apurinic or apyrimidinic site) lyase | + | ** γ-l-glutamyl-l-cysteine |
| − | ** dna glycosylase | + | * smiles: |
| − | * ec-number:
| + | ** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o |
| − | ** [http://enzyme.expasy.org/EC/4.2.99.18 ec-4.2.99.18] | + | * inchi-key: |
| − | == Reaction formula == | + | ** ritkhvbhsgluln-whfbiakzsa-m |
| − | * 1 [[Damaged-DNA-Pyrimidine]][c] '''=>''' 1 [[DNA-containing-a-Apyrimidinic-Sites]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 249.261 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ01041]]
| + | * [[GLUTATHIONE-SYN-RXN]] |
| − | ** Category: [[orthology]]
| + | * [[RXN-14430]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ12112]]
| + | * [[GLUTCYSLIG-RXN]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=γ-l-glutamyl-l-cysteine}} |
| − | * Gene: [[SJ17648]]
| + | {{#set: inchi-key=inchikey=ritkhvbhsgluln-whfbiakzsa-m}} |
| − | ** Category: [[orthology]]
| + | {{#set: molecular-weight=249.261}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ01489]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | * Gene: [[SJ10690]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ12532]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ04992]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ04314]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ12201]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ00230]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ12275]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ18415]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=dna-(apurinic or apyrimidinic site) lyase|dna glycosylase}} | |
| − | {{#set: ec-number=ec-4.2.99.18}}
| |
| − | {{#set: nb gene associated=12}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=orthology|annotation}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
| |
