Difference between revisions of "L-GLUTAMATE-5-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14916 == * common-name: ** (r)-3-hydroxyoctanoyl-coa * smiles: ** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
(Created page with "Category:metabolite == Metabolite CPDQT-36 == * common-name: ** 3-[(3'-methylthio)propyl]malate * smiles: ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] * inchi-key: ** sqxviiopmysnc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14916 ==
+
== Metabolite CPDQT-36 ==
 
* common-name:
 
* common-name:
** (r)-3-hydroxyoctanoyl-coa
+
** 3-[(3'-methylthio)propyl]malate
 
* smiles:
 
* smiles:
** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
+
** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** atvgtmkwkducms-jwbywsjjsa-j
+
** sqxviiopmysncp-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 905.7
+
** 220.24
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [[RXN-18208]]
* [[RXN-14275]]
+
* [[RXNQT-4165]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [[RXN-18208]]
* [[RXN-14276]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-3-hydroxyoctanoyl-coa}}
+
{{#set: common-name=3-[(3'-methylthio)propyl]malate}}
{{#set: inchi-key=inchikey=atvgtmkwkducms-jwbywsjjsa-j}}
+
{{#set: inchi-key=inchikey=sqxviiopmysncp-uhfffaoysa-l}}
{{#set: molecular-weight=905.7}}
+
{{#set: molecular-weight=220.24}}

Revision as of 11:15, 15 January 2021

Metabolite CPDQT-36

  • common-name:
    • 3-[(3'-methylthio)propyl]malate
  • smiles:
    • c(c(cccsc)c(o)c(=o)[o-])(=o)[o-]
  • inchi-key:
    • sqxviiopmysncp-uhfffaoysa-l
  • molecular-weight:
    • 220.24

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "3-[(3'-methylthio)propyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.