Difference between revisions of "L-GLUTAMATE-5-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17373 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * FORthi ** Category: ...")
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * smiles: ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o * inchi-key: *...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ17373 ==
+
== Metabolite L-GLUTAMATE-5-P ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** γ-l-glutamyl 5-phosphate
== Reaction(s) associated ==
+
* smiles:
* [[FORthi]]
+
** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
** pjrxvijaernuip-vkhmyheasa-l
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* molecular-weight:
{{#set: nb reaction associated=1}}
+
** 225.094
 +
== Reaction(s) known to consume the compound ==
 +
* [[G5DH]]
 +
* [[G5DHm]]
 +
* [[GLUTSEMIALDEHYDROG-RXN]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[GLUTKIN-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=γ-l-glutamyl 5-phosphate}}
 +
{{#set: inchi-key=inchikey=pjrxvijaernuip-vkhmyheasa-l}}
 +
{{#set: molecular-weight=225.094}}

Latest revision as of 11:14, 18 March 2021

Metabolite L-GLUTAMATE-5-P

  • common-name:
    • γ-l-glutamyl 5-phosphate
  • smiles:
    • c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
  • inchi-key:
    • pjrxvijaernuip-vkhmyheasa-l
  • molecular-weight:
    • 225.094

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality