Difference between revisions of "L-GLUTAMATE-5-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17271 == * common-name: ** 1-stearoyl-2-palmitoyl-glycerol * smiles: ** cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)co)=o * inchi-ke...")
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * smiles: ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o * inchi-key: *...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17271 ==
+
== Metabolite L-GLUTAMATE-5-P ==
 
* common-name:
 
* common-name:
** 1-stearoyl-2-palmitoyl-glycerol
+
** γ-l-glutamyl 5-phosphate
 
* smiles:
 
* smiles:
** cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)co)=o
+
** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
** vyqdalbeqrzdpl-dhujradrsa-n
+
** pjrxvijaernuip-vkhmyheasa-l
 
* molecular-weight:
 
* molecular-weight:
** 596.973
+
** 225.094
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
+
* [[G5DH]]
* [[RXN-1602-CPD-17271/WATER//CPD66-43/STEARIC_ACID/PROTON.46.]]
+
* [[G5DHm]]
* [[RXN-16030]]
+
* [[GLUTSEMIALDEHYDROG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
+
* [[GLUTKIN-RXN]]
* [[RXN-16030]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-stearoyl-2-palmitoyl-glycerol}}
+
{{#set: common-name=γ-l-glutamyl 5-phosphate}}
{{#set: inchi-key=inchikey=vyqdalbeqrzdpl-dhujradrsa-n}}
+
{{#set: inchi-key=inchikey=pjrxvijaernuip-vkhmyheasa-l}}
{{#set: molecular-weight=596.973}}
+
{{#set: molecular-weight=225.094}}

Latest revision as of 11:14, 18 March 2021

Metabolite L-GLUTAMATE-5-P

  • common-name:
    • γ-l-glutamyl 5-phosphate
  • smiles:
    • c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
  • inchi-key:
    • pjrxvijaernuip-vkhmyheasa-l
  • molecular-weight:
    • 225.094

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality