Difference between revisions of "L-GLUTAMATE-5-P"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20176 == * transcription-direction: ** negative * right-end-position: ** 620243 * left-end-position: ** 614939 * centisome-position: ** 98.993546...") |
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * smiles: ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o * inchi-key: *...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-GLUTAMATE-5-P == |
− | * | + | * common-name: |
− | ** | + | ** γ-l-glutamyl 5-phosphate |
− | * | + | * smiles: |
− | ** | + | ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** pjrxvijaernuip-vkhmyheasa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 225.094 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[G5DH]] | |
− | == Reaction(s) | + | * [[G5DHm]] |
− | * [[ | + | * [[GLUTSEMIALDEHYDROG-RXN]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[GLUTKIN-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=γ-l-glutamyl 5-phosphate}} | |
− | == | + | {{#set: inchi-key=inchikey=pjrxvijaernuip-vkhmyheasa-l}} |
− | * [[ | + | {{#set: molecular-weight=225.094}} |
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite L-GLUTAMATE-5-P
- common-name:
- γ-l-glutamyl 5-phosphate
- smiles:
- c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
- inchi-key:
- pjrxvijaernuip-vkhmyheasa-l
- molecular-weight:
- 225.094