Difference between revisions of "L-GLUTAMATE-5-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20176 == * transcription-direction: ** negative * right-end-position: ** 620243 * left-end-position: ** 614939 * centisome-position: ** 98.993546...")
 
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * smiles: ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o * inchi-key: *...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ20176 ==
+
== Metabolite L-GLUTAMATE-5-P ==
* transcription-direction:
+
* common-name:
** negative
+
** γ-l-glutamyl 5-phosphate
* right-end-position:
+
* smiles:
** 620243
+
** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
* left-end-position:
+
* inchi-key:
** 614939
+
** pjrxvijaernuip-vkhmyheasa-l
* centisome-position:
+
* molecular-weight:
** 98.993546   
+
** 225.094
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[G5DH]]
== Reaction(s) associated ==
+
* [[G5DHm]]
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
+
* [[GLUTSEMIALDEHYDROG-RXN]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLUTKIN-RXN]]
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=γ-l-glutamyl 5-phosphate}}
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=pjrxvijaernuip-vkhmyheasa-l}}
* [[TRNA-CHARGING-PWY]]
+
{{#set: molecular-weight=225.094}}
** '''21''' reactions found over '''21''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=620243}}
 
{{#set: left-end-position=614939}}
 
{{#set: centisome-position=98.993546    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite L-GLUTAMATE-5-P

  • common-name:
    • γ-l-glutamyl 5-phosphate
  • smiles:
    • c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
  • inchi-key:
    • pjrxvijaernuip-vkhmyheasa-l
  • molecular-weight:
    • 225.094

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality