Difference between revisions of "L-GLUTAMATE-5-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14916 == * common-name: ** (r)-3-hydroxyoctanoyl-coa * smiles: ** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...") |
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * smiles: ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o * inchi-key: *...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-GLUTAMATE-5-P == |
* common-name: | * common-name: | ||
− | ** | + | ** γ-l-glutamyl 5-phosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pjrxvijaernuip-vkhmyheasa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 225.094 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[G5DH]] |
− | * [[RXN | + | * [[G5DHm]] |
+ | * [[GLUTSEMIALDEHYDROG-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GLUTKIN-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=γ-l-glutamyl 5-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pjrxvijaernuip-vkhmyheasa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=225.094}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite L-GLUTAMATE-5-P
- common-name:
- γ-l-glutamyl 5-phosphate
- smiles:
- c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
- inchi-key:
- pjrxvijaernuip-vkhmyheasa-l
- molecular-weight:
- 225.094