Difference between revisions of "L-GLUTAMATE-5-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GAMMA-BUTYROBETAINE == * common-name: ** γ-butyrobetaine * smiles: ** c[n+](cccc([o-])=o)(c)c * inchi-key: ** jhpnvniexxlntr-uhfffa...")
(Created page with "Category:metabolite == Metabolite CPD-14916 == * common-name: ** (r)-3-hydroxyoctanoyl-coa * smiles: ** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GAMMA-BUTYROBETAINE ==
+
== Metabolite CPD-14916 ==
 
* common-name:
 
* common-name:
** γ-butyrobetaine
+
** (r)-3-hydroxyoctanoyl-coa
 
* smiles:
 
* smiles:
** c[n+](cccc([o-])=o)(c)c
+
** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
 
* inchi-key:
 
* inchi-key:
** jhpnvniexxlntr-uhfffaoysa-n
+
** atvgtmkwkducms-jwbywsjjsa-j
 
* molecular-weight:
 
* molecular-weight:
** 145.201
+
** 905.7
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.14.11.1-RXN]]
+
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
 +
* [[RXN-14275]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
 +
* [[RXN-14276]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-butyrobetaine}}
+
{{#set: common-name=(r)-3-hydroxyoctanoyl-coa}}
{{#set: inchi-key=inchikey=jhpnvniexxlntr-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=atvgtmkwkducms-jwbywsjjsa-j}}
{{#set: molecular-weight=145.201}}
+
{{#set: molecular-weight=905.7}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-14916

  • common-name:
    • (r)-3-hydroxyoctanoyl-coa
  • smiles:
    • cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • atvgtmkwkducms-jwbywsjjsa-j
  • molecular-weight:
    • 905.7

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality