Difference between revisions of "L-GLUTAMATE GAMMA-SEMIALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ISOPHENOXAZINE == * common-name: ** isophenoxazine * smiles: ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) * inchi-key: ** rdjxpxhqenrcn...") |
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE_GAMMA-SEMIALDEHYDE == * common-name: ** l-glutamate-5-semialdehyde * smiles: ** c(cc([n+])c([o-])=o)[ch]=o * inchi-key: ** ka...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-GLUTAMATE_GAMMA-SEMIALDEHYDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-glutamate-5-semialdehyde |
* smiles: | * smiles: | ||
| − | ** | + | ** c(cc([n+])c([o-])=o)[ch]=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kabxuufdpuojmw-bypyzucnsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 131.131 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]] | ||
| + | * [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]] | ||
| + | * [[RXN-14116]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[G5DH]] |
| + | * [[G5DHm]] | ||
| + | * [[GLUTSEMIALDEHYDROG-RXN]] | ||
| + | * [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]] | ||
| + | * [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-glutamate-5-semialdehyde}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kabxuufdpuojmw-bypyzucnsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=131.131}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite L-GLUTAMATE_GAMMA-SEMIALDEHYDE
- common-name:
- l-glutamate-5-semialdehyde
- smiles:
- c(cc([n+])c([o-])=o)[ch]=o
- inchi-key:
- kabxuufdpuojmw-bypyzucnsa-n
- molecular-weight:
- 131.131
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- G5DH
- G5DHm
- GLUTSEMIALDEHYDROG-RXN
- ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN
- ORNITHINE-GLU-AMINOTRANSFERASE-RXN
