Difference between revisions of "L-GLUTAMATE GAMMA-SEMIALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNKIN-RXN MANNKIN-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org...")
(Created page with "Category:metabolite == Metabolite ISOPHENOXAZINE == * common-name: ** isophenoxazine * smiles: ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) * inchi-key: ** rdjxpxhqenrcn...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNKIN-RXN MANNKIN-RXN] ==
+
== Metabolite ISOPHENOXAZINE ==
* direction:
+
* common-name:
** left-to-right
+
** isophenoxazine
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.7.1.7 ec-2.7.1.7]
+
** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n)))
== Reaction formula ==
+
* inchi-key:
* 1 [[ATP]][c] '''+''' 1 [[D-mannopyranose]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CPD-15979]][c] '''+''' 1 [[PROTON]][c]
+
** rdjxpxhqenrcng-uhfffaoysa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ04919]]
+
** 212.207
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[O-AMINOPHENOL-OXIDASE-RXN]]
* [[PWY-3861]], mannitol degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3861 PWY-3861]
+
== Reaction(s) of unknown directionality ==
** '''2''' reactions found over '''4''' reactions in the full pathway
+
{{#set: common-name=isophenoxazine}}
* [[PWY-6140]], CMP-2-keto-3-deoxy-D-glycero-D-galacto-nononate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6140 PWY-6140]
+
{{#set: inchi-key=inchikey=rdjxpxhqenrcng-uhfffaoysa-n}}
** '''1''' reactions found over '''4''' reactions in the full pathway
+
{{#set: molecular-weight=212.207}}
* [[PWY-6992]], 1,5-anhydrofructose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6992 PWY-6992]
 
** '''4''' reactions found over '''5''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11029 11029]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01326 R01326]
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-2.7.1.7}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=3}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:37, 18 December 2020

Metabolite ISOPHENOXAZINE

  • common-name:
    • isophenoxazine
  • smiles:
    • c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n)))
  • inchi-key:
    • rdjxpxhqenrcng-uhfffaoysa-n
  • molecular-weight:
    • 212.207

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality