Difference between revisions of "L-GLUTAMATE GAMMA-SEMIALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ISOPHENOXAZINE == * common-name: ** isophenoxazine * smiles: ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) * inchi-key: ** rdjxpxhqenrcn...") |
(Created page with "Category:metabolite == Metabolite ETR-Quinols == * common-name: ** an electron-transfer quinol == Reaction(s) known to consume the compound == * RXN-15816 == Reaction(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ETR-Quinols == |
* common-name: | * common-name: | ||
− | ** | + | ** an electron-transfer quinol |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-15816]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] |
+ | * [[NQOR-RXN]] | ||
+ | * [[RXN-11356]] | ||
+ | * [[RXN-11357]] | ||
+ | * [[RXN-12242]] | ||
+ | * [[RXN-14903]] | ||
+ | * [[RXN-14971]] | ||
+ | * [[RXN-15745]] | ||
+ | * [[RXN0-7229]] | ||
+ | * [[RXN0-7230]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an electron-transfer quinol}} |
− | |||
− |
Revision as of 14:59, 5 January 2021
Contents
Metabolite ETR-Quinols
- common-name:
- an electron-transfer quinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- DIHYDROOROTATE-DEHYDROGENASE-RXN
- NQOR-RXN
- RXN-11356
- RXN-11357
- RXN-12242
- RXN-14903
- RXN-14971
- RXN-15745
- RXN0-7229
- RXN0-7230