Difference between revisions of "L-GLUTAMATE GAMMA-SEMIALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHYTYL-PYROPHOSPHATE == * common-name: ** phytyl diphosphate * smiles: ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c * inc...") |
(Created page with "Category:metabolite == Metabolite CPD-358 == * common-name: ** (r)-lactaldehyde * smiles: ** cc([ch]=o)o * inchi-key: ** bsabbbmnwqwllu-gsvougtgsa-n * molecular-weight: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-358 == |
* common-name: | * common-name: | ||
− | ** | + | ** (r)-lactaldehyde |
* smiles: | * smiles: | ||
− | ** cc | + | ** cc([ch]=o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bsabbbmnwqwllu-gsvougtgsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 74.079 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(r)-lactaldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bsabbbmnwqwllu-gsvougtgsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=74.079}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-358
- common-name:
- (r)-lactaldehyde
- smiles:
- cc([ch]=o)o
- inchi-key:
- bsabbbmnwqwllu-gsvougtgsa-n
- molecular-weight:
- 74.079