Difference between revisions of "L-GULONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-90 == * common-name: ** kaempferol * smiles: ** c3(c=c(o)c=cc(c1(=c([o-])c(=o)c2(c(o)=cc(o)=cc(o1)=2)))=3) * inchi-key: ** iyrmwmyz...") |
(Created page with "Category:metabolite == Metabolite AICAR == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite AICAR == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** notgfiuvdgnkri-uuokfmhzsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 336.197 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[AIAL]] |
| − | * [[RXN | + | * [[AICARSYN-RXN]] |
| − | * [[ | + | * [[AICARTRANSFORM-RXN]] |
| + | * [[FPAIF]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[AIAL]] |
| + | * [[AICARSYN-RXN]] | ||
| + | * [[AICARTRANSFORM-RXN]] | ||
| + | * [[FPAIF]] | ||
| + | * [[GLUTAMIDOTRANS-RXN]] | ||
| + | * [[RXN-14270]] | ||
| + | * [[RXN-17900]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=notgfiuvdgnkri-uuokfmhzsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=336.197}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite AICAR
- common-name:
- 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
- smiles:
- c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
- inchi-key:
- notgfiuvdgnkri-uuokfmhzsa-l
- molecular-weight:
- 336.197
