|
|
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ21294 == | + | == Metabolite CPD-14419 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** 3r-hydroxy-icosatrienoyl-coa |
| − | * right-end-position:
| + | * smiles: |
| − | ** 170545
| + | ** ccc=ccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 137602 | + | ** aukmttjfpkefdq-ivictrqzsa-j |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 70.67531 | + | ** 1067.974 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[RXN-13001]] |
| − | == Reaction(s) associated == | + | == Reaction(s) known to produce the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[RXN-12994]] |
| − | * [[D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=3r-hydroxy-icosatrienoyl-coa}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: inchi-key=inchikey=aukmttjfpkefdq-ivictrqzsa-j}} |
| − | * [[DLACTDEHYDROGNAD-RXN]]
| + | {{#set: molecular-weight=1067.974}} |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[GLYCOLATEDEHYDRO-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-969]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN0-7229]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[S-2-HYDROXY-ACID-OXIDASE-RXN]]
| |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[MGLDLCTANA-PWY]] | |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[P122-PWY]] | |
| − | ** '''16''' reactions found over '''18''' reactions in the full pathway
| |
| − | * [[FERMENTATION-PWY]]
| |
| − | ** '''11''' reactions found over '''16''' reactions in the full pathway
| |
| − | * [[PWY4LZ-257]]
| |
| − | ** '''7''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-6454]]
| |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-6901]]
| |
| − | ** '''10''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[ALACAT2-PWY]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-6649]]
| |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[GLYOXDEG-PWY]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[GLYCOLATEMET-PWY]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-5951]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[PWY3O-246]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[PWY-181]]
| |
| − | ** '''5''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-6387]]
| |
| − | ** '''2''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7953]]
| |
| − | ** '''2''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-6386]]
| |
| − | ** '''2''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY0-1261]]
| |
| − | ** '''3''' reactions found over '''12''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=170545}} | |
| − | {{#set: left-end-position=137602}}
| |
| − | {{#set: centisome-position=70.67531 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=8}}
| |
| − | {{#set: nb pathway associated=17}}
| |
