Difference between revisions of "L-GULONO-1-4-LACTONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-548 == * common-name: ** s-formylglutathione * smiles: ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] * inchi-key: ** fhxagoic...") |
(Created page with "Category:metabolite == Metabolite L-GULONO-1-4-LACTONE == * common-name: ** l-gulono-1,4-lactone * smiles: ** c(c([ch]1(c(c(c(o1)=o)o)o))o)o * inchi-key: ** sxzycxmupbbulw...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-GULONO-1-4-LACTONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-gulono-1,4-lactone |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c([ch]1(c(c(c(o1)=o)o)o))o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sxzycxmupbbulw-sknvomklsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 178.141 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[L-GULONOLACTONE-OXIDASE-RXN]] |
| − | * [[ | + | * [[RXN-13689]] |
| + | * [[RXN-8783]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-gulono-1,4-lactone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sxzycxmupbbulw-sknvomklsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=178.141}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite L-GULONO-1-4-LACTONE
- common-name:
- l-gulono-1,4-lactone
- smiles:
- c(c([ch]1(c(c(c(o1)=o)o)o))o)o
- inchi-key:
- sxzycxmupbbulw-sknvomklsa-n
- molecular-weight:
- 178.141
