Difference between revisions of "L-Galactopyranose"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-108 == * common-name: ** 4-methylphenol * smiles: ** cc1(c=cc(=cc=1)o) * inchi-key: ** iwdclrjobjjrnh-uhfffaoysa-n * molecular-weight...") |
(Created page with "Category:metabolite == Metabolite CPD-786 == * common-name: ** (4z)-2-oxohept-4-enedioate * smiles: ** c(ccc=cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hyvszvzmtyihkf-iwqzzh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-786 == |
* common-name: | * common-name: | ||
| − | ** 4- | + | ** (4z)-2-oxohept-4-enedioate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(ccc=cc(c([o-])=o)=o)([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hyvszvzmtyihkf-iwqzzhsrsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 170.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1K-87]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=4- | + | {{#set: common-name=(4z)-2-oxohept-4-enedioate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hyvszvzmtyihkf-iwqzzhsrsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=170.121}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-786
- common-name:
- (4z)-2-oxohept-4-enedioate
- smiles:
- c(ccc=cc(c([o-])=o)=o)([o-])=o
- inchi-key:
- hyvszvzmtyihkf-iwqzzhsrsa-l
- molecular-weight:
- 170.121
