Difference between revisions of "L-Galactopyranose"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-GLUCARATE == * common-name: ** d-glucarate * smiles: ** c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-] * inchi-key: ** dslzvsrjtyrbfb-lleiaeiesa-...") |
(Created page with "Category:metabolite == Metabolite L-Galactopyranose == * common-name: ** l-galactopyranose == Reaction(s) known to consume the compound == * RXN-1884 == Reaction(s) kn...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-Galactopyranose == |
* common-name: | * common-name: | ||
− | ** | + | ** l-galactopyranose |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-1884]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXNQT-4142]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-galactopyranose}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite L-Galactopyranose
- common-name:
- l-galactopyranose