Difference between revisions of "L-Glutaminyl-Peptides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4821 == * common-name: ** kanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))...")
(Created page with "Category:metabolite == Metabolite L-Glutaminyl-Peptides == * common-name: ** an n-terminal l-glutaminyl-[protein] == Reaction(s) known to consume the compound == == Reacti...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4821 ==
+
== Metabolite L-Glutaminyl-Peptides ==
 
* common-name:
 
* common-name:
** kanamycin a
+
** an n-terminal l-glutaminyl-[protein]
* smiles:
 
** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
 
* inchi-key:
 
** sbujhosqtjfqjx-noamyhissa-r
 
* molecular-weight:
 
** 488.534
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13167]]
 
* [[RXN-15285]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17893]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=kanamycin a}}
+
{{#set: common-name=an n-terminal l-glutaminyl-[protein]}}
{{#set: inchi-key=inchikey=sbujhosqtjfqjx-noamyhissa-r}}
 
{{#set: molecular-weight=488.534}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite L-Glutaminyl-Peptides

  • common-name:
    • an n-terminal l-glutaminyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-glutaminyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.