Difference between revisions of "L-HISTIDINOL-P"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6883 RXN-6883] == * direction: ** left-to-right * common-name: ** ubiquinol:oxygen oxidoreducta...") |
(Created page with "Category:metabolite == Metabolite L-HISTIDINOL-P == * common-name: ** l-histidinol phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+]) * inchi-key: ** cwnderhthmwb...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-HISTIDINOL-P == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** l-histidinol phosphate |
− | * | + | * smiles: |
− | ** | + | ** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+]) |
− | == | + | * inchi-key: |
− | + | ** cwnderhthmwbsi-yfkpbyrvsa-m | |
− | + | * molecular-weight: | |
− | * | + | ** 220.144 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[HISTAMINOTRANS-RXN]] |
− | + | * [[HISTIDPHOS-RXN]] | |
− | ** | + | * [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[HISTAMINOTRANS-RXN]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=l-histidinol phosphate}} | |
− | * | + | {{#set: inchi-key=inchikey=cwnderhthmwbsi-yfkpbyrvsa-m}} |
− | + | {{#set: molecular-weight=220.144}} | |
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite L-HISTIDINOL-P
- common-name:
- l-histidinol phosphate
- smiles:
- c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
- inchi-key:
- cwnderhthmwbsi-yfkpbyrvsa-m
- molecular-weight:
- 220.144
Reaction(s) known to consume the compound
- HISTAMINOTRANS-RXN
- HISTIDPHOS-RXN
- [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]