Difference between revisions of "L-HISTIDINOL-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-723 RXN0-723] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:metabolite == Metabolite L-HISTIDINOL-P == * common-name: ** l-histidinol phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+]) * inchi-key: ** cwnderhthmwb...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-723 RXN0-723] ==
+
== Metabolite L-HISTIDINOL-P ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** l-histidinol phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.98.6 ec-1.1.98.6]
+
** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CTP]][c] '''+''' 1 [[FORMATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[DCTP]][c] '''+''' 1 [[WATER]][c]
+
** cwnderhthmwbsi-yfkpbyrvsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ17066]]
+
** 220.144
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[HISTAMINOTRANS-RXN]]
−
== Pathway(s) ==
+
* [[HISTIDPHOS-RXN]]
−
* [[PWY-7187]], pyrimidine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7187 PWY-7187]
+
* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166]
+
* [[HISTAMINOTRANS-RXN]]
−
** '''14''' reactions found over '''13''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=l-histidinol phosphate}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=cwnderhthmwbsi-yfkpbyrvsa-m}}
−
== External links  ==
+
{{#set: molecular-weight=220.144}}
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=51621 51621]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.1.98.6}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite L-HISTIDINOL-P

  • common-name:
    • l-histidinol phosphate
  • smiles:
    • c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
  • inchi-key:
    • cwnderhthmwbsi-yfkpbyrvsa-m
  • molecular-weight:
    • 220.144

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-HISTIDINOL-P&oldid=138904"