Difference between revisions of "L-IDONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16458 == * common-name: ** 7,8-dihydrolumazine * smiles: ** c2(=o)(c1(=c(ncc=n1)nc(=o)n2)) * inchi-key: ** myjneehzesremo-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite L-IDONATE == * common-name: ** l-idonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-sknvomklsa-m * molecul...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-IDONATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-idonate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rghnjxzeokukbd-sknvomklsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 195.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12107]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-idonate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rghnjxzeokukbd-sknvomklsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=195.149}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite L-IDONATE
- common-name:
- l-idonate
- smiles:
- c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
- inchi-key:
- rghnjxzeokukbd-sknvomklsa-m
- molecular-weight:
- 195.149
