Difference between revisions of "L-IDONATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21840 == * transcription-direction: ** positive * right-end-position: ** 158762 * left-end-position: ** 142070 * centisome-position: ** 76.693855...") |
(Created page with "Category:metabolite == Metabolite L-IDONATE == * common-name: ** l-idonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-sknvomklsa-m * molecul...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-IDONATE == |
− | * | + | * common-name: |
− | ** | + | ** l-idonate |
− | * | + | * smiles: |
− | ** | + | ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** rghnjxzeokukbd-sknvomklsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 195.149 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-12107]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=l-idonate}} | |
− | + | {{#set: inchi-key=inchikey=rghnjxzeokukbd-sknvomklsa-m}} | |
− | {{#set: | + | {{#set: molecular-weight=195.149}} |
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite L-IDONATE
- common-name:
- l-idonate
- smiles:
- c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
- inchi-key:
- rghnjxzeokukbd-sknvomklsa-m
- molecular-weight:
- 195.149