Difference between revisions of "L-IDONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs == * common-name: ** a cis,cis-delta17,35-3-hydroxyc54:2-[acp] == Reaction(s) known to consume the com...")
(Created page with "Category:metabolite == Metabolite L-IDONATE == * common-name: ** l-idonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-sknvomklsa-m * molecul...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs ==
+
== Metabolite L-IDONATE ==
 
* common-name:
 
* common-name:
** a cis,cis-delta17,35-3-hydroxyc54:2-[acp]
+
** l-idonate
 +
* smiles:
 +
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
 +
* inchi-key:
 +
** rghnjxzeokukbd-sknvomklsa-m
 +
* molecular-weight:
 +
** 195.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1G-220]]
+
* [[RXN-12107]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cis,cis-delta17,35-3-hydroxyc54:2-[acp]}}
+
{{#set: common-name=l-idonate}}
 +
{{#set: inchi-key=inchikey=rghnjxzeokukbd-sknvomklsa-m}}
 +
{{#set: molecular-weight=195.149}}

Latest revision as of 11:12, 18 March 2021

Metabolite L-IDONATE

  • common-name:
    • l-idonate
  • smiles:
    • c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
  • inchi-key:
    • rghnjxzeokukbd-sknvomklsa-m
  • molecular-weight:
    • 195.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality