Difference between revisions of "L-IDONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs == * common-name: ** a cis,cis-delta17,35-3-hydroxyc54:2-[acp] == Reaction(s) known to consume the com...") |
(Created page with "Category:metabolite == Metabolite CPD-12019 == * common-name: ** 5-methoxyindoleacetaldehyde * smiles: ** coc2(c=cc1(=c(c(cc=o)=cn1)c=2)) * inchi-key: ** xvhhcgdxcdkklh-uh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12019 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-methoxyindoleacetaldehyde |
| + | * smiles: | ||
| + | ** coc2(c=cc1(=c(c(cc=o)=cn1)c=2)) | ||
| + | * inchi-key: | ||
| + | ** xvhhcgdxcdkklh-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 189.213 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11067]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-methoxyindoleacetaldehyde}} |
| + | {{#set: inchi-key=inchikey=xvhhcgdxcdkklh-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=189.213}} | ||
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-12019
- common-name:
- 5-methoxyindoleacetaldehyde
- smiles:
- coc2(c=cc1(=c(c(cc=o)=cn1)c=2))
- inchi-key:
- xvhhcgdxcdkklh-uhfffaoysa-n
- molecular-weight:
- 189.213
