Difference between revisions of "L-ORNITHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROHYDROXYPHOSPHORYLPYRUVATE == * common-name: ** 3-(hydroxyphosphinoyl)pyruvate * smiles: ** c([o-])(=o)c(=o)c[ph]([o-])=o * inchi-k...")
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+] * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * molecul...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROHYDROXYPHOSPHORYLPYRUVATE ==
+
== Metabolite L-ORNITHINE ==
 
* common-name:
 
* common-name:
** 3-(hydroxyphosphinoyl)pyruvate
+
** l-ornithine
 
* smiles:
 
* smiles:
** c([o-])(=o)c(=o)c[ph]([o-])=o
+
** c(=o)([o-])c([n+])ccc[n+]
 
* inchi-key:
 
* inchi-key:
** vhafwrwghgszdl-uhfffaoysa-l
+
** ahlphdhhmvztml-bypyzucnsa-o
 
* molecular-weight:
 
* molecular-weight:
** 150.027
+
** 133.17
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.8.23-RXN]]
+
* [[ACETYLORNDEACET-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[ORDC]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNDECARBOX-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13482]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.8.23-RXN]]
+
* [[ACETYLORNDEACET-RXN]]
* [[RXN-10828]]
+
* [[AODAA]]
 +
* [[ARGINASE-RXN]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13482]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(hydroxyphosphinoyl)pyruvate}}
+
{{#set: common-name=l-ornithine}}
{{#set: inchi-key=inchikey=vhafwrwghgszdl-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
{{#set: molecular-weight=150.027}}
+
{{#set: molecular-weight=133.17}}

Latest revision as of 11:16, 18 March 2021