Difference between revisions of "L-ORNITHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9624 RXN-9624] == * direction: ** left-to-right * common-name: ** palmitoyl-coa hydrolase * ec-...")
 
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+] * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * molecul...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9624 RXN-9624] ==
+
== Metabolite L-ORNITHINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** palmitoyl-coa hydrolase
+
** l-ornithine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.2.2 ec-3.1.2.2]
+
** c(=o)([o-])c([n+])ccc[n+]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[STEAROYL-COA]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[STEARIC_ACID]][c]
+
** ahlphdhhmvztml-bypyzucnsa-o
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09703]]
+
** 133.17
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[ACETYLORNDEACET-RXN]]
−
* Gene: [[SJ18316]]
+
* [[ARGINASE-RXN]]
−
** Category: [[orthology]]
+
* [[ORDC]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ORNCARBAMTRANSFER-RXN]]
−
== Pathway(s)  ==
+
* [[ORNDECARBOX-RXN]]
−
* [[PWY3O-355]], stearate biosynthesis III (fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-355 PWY3O-355]
+
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
−
* [[PWY-5972]], stearate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5972 PWY-5972]
+
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN-13482]]
−
* [[PWY-6733]], sporopollenin precursors biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6733 PWY-6733]
+
* [[biomass_rxn]]
−
** '''8''' reactions found over '''18''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[ACETYLORNDEACET-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[AODAA]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[ARGINASE-RXN]]
−
== External links  ==
+
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
−
* RHEA:
+
* [[ORNCARBAMTRANSFER-RXN]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30140 30140]
+
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
−
* LIGAND-RXN:
+
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R08174 R08174]
+
* [[RXN-13482]]
−
{{#set: direction=left-to-right}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=palmitoyl-coa hydrolase}}
+
{{#set: common-name=l-ornithine}}
−
{{#set: ec-number=ec-3.1.2.2}}
+
{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
−
{{#set: nb gene associated=2}}
+
{{#set: molecular-weight=133.17}}
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite L-ORNITHINE

  • common-name:
    • l-ornithine
  • smiles:
    • c(=o)([o-])c([n+])ccc[n+]
  • inchi-key:
    • ahlphdhhmvztml-bypyzucnsa-o
  • molecular-weight:
    • 133.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-ORNITHINE&oldid=138981"