Difference between revisions of "L-ORNITHINE"

Latest revision as of 11:16, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-12120 ==
+== Metabolite L-ORNITHINE ==
 * common-name:
-** demethylmenaquinol-11
+** l-ornithine
 * smiles:
-** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
+** c(=o)([o-])c([n+])ccc[n+]
 * inchi-key:
-** wvrzwraihitkpi-sokmhqjssa-n
+** ahlphdhhmvztml-bypyzucnsa-o
 * molecular-weight:
-** 909.472
+** 133.17
 == Reaction(s) known to consume the compound ==
-* [[RXN-9362]]
+* [[ACETYLORNDEACET-RXN]]
+* [[ARGINASE-RXN]]
+* [[ORDC]]
+* [[ORNCARBAMTRANSFER-RXN]]
+* [[ORNDECARBOX-RXN]]
+* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+* [[ORNITHINE-CYCLODEAMINASE-RXN]]
+* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
+* [[RXN-13482]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
+* [[ACETYLORNDEACET-RXN]]
+* [[AODAA]]
+* [[ARGINASE-RXN]]
+* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
+* [[ORNCARBAMTRANSFER-RXN]]
+* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
+* [[RXN-13482]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=demethylmenaquinol-11}}
+{{#set: common-name=l-ornithine}}
-{{#set: inchi-key=inchikey=wvrzwraihitkpi-sokmhqjssa-n}}
+{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
-{{#set: molecular-weight=909.472}}
+{{#set: molecular-weight=133.17}}