Difference between revisions of "L-PHOSPHATIDATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19013 == * common-name: ** 2-methylpropane-1,2-diol * smiles: ** cc(o)(c)co * inchi-key: ** btvwzwfkmiusgs-uhfffaoysa-n * molecular-w...") |
(Created page with "Category:metabolite == Metabolite CPD-729 == * common-name: ** 12-oxo-cis-10,15-phytodienoate * smiles: ** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o) * inchi-key: ** pmtmafapl...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-729 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 12-oxo-cis-10,15-phytodienoate |
* smiles: | * smiles: | ||
| − | ** cc(o)( | + | ** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pmtmafaplcgxgk-jmtmcxqrsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 291.409 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=12-oxo-cis-10,15-phytodienoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pmtmafaplcgxgk-jmtmcxqrsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=291.409}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-729
- common-name:
- 12-oxo-cis-10,15-phytodienoate
- smiles:
- ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o)
- inchi-key:
- pmtmafaplcgxgk-jmtmcxqrsa-m
- molecular-weight:
- 291.409
