Difference between revisions of "L-PHOSPHATIDATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-729 == * common-name: ** 12-oxo-cis-10,15-phytodienoate * smiles: ** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o) * inchi-key: ** pmtmafapl...")
(Created page with "Category:metabolite == Metabolite L-PHOSPHATIDATE == * common-name: ** a 1,2-diacyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * CDPDIGLYSYN...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-729 ==
+
== Metabolite L-PHOSPHATIDATE ==
 
* common-name:
 
* common-name:
** 12-oxo-cis-10,15-phytodienoate
+
** a 1,2-diacyl-sn-glycerol 3-phosphate
* smiles:
 
** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o)
 
* inchi-key:
 
** pmtmafaplcgxgk-jmtmcxqrsa-m
 
* molecular-weight:
 
** 291.409
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
+
* [[CDPDIGLYSYN-RXN]]
 +
* [[PHOSPHATIDATE-PHOSPHATASE-RXN]]
 +
* [[RXN-16066]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]]
 +
* [[DIACYLGLYKIN-RXN]]
 +
* [[PHOSCHOL-RXN]]
 +
* [[RXN-11277]]
 +
* [[RXN-12116]]
 +
* [[RXN-12959]]
 +
* [[RXN-16066]]
 +
* [[RXN-1623]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=12-oxo-cis-10,15-phytodienoate}}
+
{{#set: common-name=a 1,2-diacyl-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=pmtmafaplcgxgk-jmtmcxqrsa-m}}
 
{{#set: molecular-weight=291.409}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite L-PHOSPHATIDATE

  • common-name:
    • a 1,2-diacyl-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality