Difference between revisions of "L-PHOSPHATIDATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CDP-CHOLINE == * common-name: ** cdp-choline * smiles: ** c[n+](c)(c)ccop([o-])(=o)op([o-])(=o)occ1(oc(c(o)c(o)1)n2(c=cc(=nc2=o)n)) * inc...") |
(Created page with "Category:metabolite == Metabolite L-PHOSPHATIDATE == * common-name: ** a 1,2-diacyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * CDPDIGLYSYN...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-PHOSPHATIDATE == |
* common-name: | * common-name: | ||
− | ** | + | ** a 1,2-diacyl-sn-glycerol 3-phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[CDPDIGLYSYN-RXN]] |
− | * [[ | + | * [[PHOSPHATIDATE-PHOSPHATASE-RXN]] |
− | + | * [[RXN-16066]] | |
− | * [[RXN- | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]] |
− | * [[ | + | * [[DIACYLGLYKIN-RXN]] |
− | * [[ | + | * [[PHOSCHOL-RXN]] |
− | * [[RXN- | + | * [[RXN-11277]] |
− | * [[RXN- | + | * [[RXN-12116]] |
+ | * [[RXN-12959]] | ||
+ | * [[RXN-16066]] | ||
+ | * [[RXN-1623]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 1,2-diacyl-sn-glycerol 3-phosphate}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite L-PHOSPHATIDATE
- common-name:
- a 1,2-diacyl-sn-glycerol 3-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN
- DIACYLGLYKIN-RXN
- PHOSCHOL-RXN
- RXN-11277
- RXN-12116
- RXN-12959
- RXN-16066
- RXN-1623