Difference between revisions of "L-PHOSPHATIDATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LONG-CHAIN-KETONE == * common-name: ** a ketone == Reaction(s) known to consume the compound == * CARBONYL-REDUCTASE-NADPH-RXN * RX...") |
(Created page with "Category:metabolite == Metabolite CPD-19144 == * common-name: ** (7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-19144 == |
* common-name: | * common-name: | ||
− | ** | + | ** (7z)-hexadecenoyl-coa |
+ | * smiles: | ||
+ | ** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** mjwmoldkmbisob-ydggzukgsa-j | ||
+ | * molecular-weight: | ||
+ | ** 999.899 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-17779]] | |
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-17778]] | |
− | |||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(7z)-hexadecenoyl-coa}} |
+ | {{#set: inchi-key=inchikey=mjwmoldkmbisob-ydggzukgsa-j}} | ||
+ | {{#set: molecular-weight=999.899}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-19144
- common-name:
- (7z)-hexadecenoyl-coa
- smiles:
- ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- mjwmoldkmbisob-ydggzukgsa-j
- molecular-weight:
- 999.899