Difference between revisions of "L-PHOSPHATIDATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CDP-CHOLINE == * common-name: ** cdp-choline * smiles: ** c[n+](c)(c)ccop([o-])(=o)op([o-])(=o)occ1(oc(c(o)c(o)1)n2(c=cc(=nc2=o)n)) * inc...") |
(Created page with "Category:metabolite == Metabolite Octanoyl-ACPs == * common-name: ** an octanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-13037 * RXN-9527 * R...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Octanoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an octanoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-13037]] | |
| − | * [[RXN- | + | * [[RXN-9527]] |
| − | * [[RXN- | + | * [[RXN-9651]] |
| − | * [[RXN- | + | * [[RXN0-947]] |
| − | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-9526]] | |
| − | + | * [[RXN-9659]] | |
| − | |||
| − | * [[RXN- | ||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an octanoyl-[acp]}} |
| − | |||
| − | |||
Revision as of 18:53, 14 January 2021
Contents
Metabolite Octanoyl-ACPs
- common-name:
- an octanoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an octanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
