Difference between revisions of "L-SELENOCYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Peptide-with-N-terminal-Aspartate == * common-name: ** a peptide with an n-terminal l-aspartate == Reaction(s) known to consume the compo...")
(Created page with "Category:metabolite == Metabolite INOSITOL-1-4-5-TRISPHOSPHATE == * common-name: ** d-myo-inositol (1,4,5)-trisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Peptide-with-N-terminal-Aspartate ==
+
== Metabolite INOSITOL-1-4-5-TRISPHOSPHATE ==
 
* common-name:
 
* common-name:
** a peptide with an n-terminal l-aspartate
+
** d-myo-inositol (1,4,5)-trisphosphate
 +
* smiles:
 +
** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
 +
* inchi-key:
 +
** mmwciqzxvozegg-xjtpdsdzsa-h
 +
* molecular-weight:
 +
** 414.049
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.4.11.21-RXN]]
+
* [[2.7.1.127-RXN]]
 +
* [[2.7.1.151-RXN]]
 +
* [[3.1.3.56-RXN]]
 +
* [[RXN-10948]]
 +
* [[RXN-13197]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.1.4.11-RXN]]
 +
* [[RXN-10948]]
 +
* [[RXN-13197]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a peptide with an n-terminal l-aspartate}}
+
{{#set: common-name=d-myo-inositol (1,4,5)-trisphosphate}}
 +
{{#set: inchi-key=inchikey=mmwciqzxvozegg-xjtpdsdzsa-h}}
 +
{{#set: molecular-weight=414.049}}

Revision as of 18:55, 14 January 2021

Metabolite INOSITOL-1-4-5-TRISPHOSPHATE

  • common-name:
    • d-myo-inositol (1,4,5)-trisphosphate
  • smiles:
    • c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
  • inchi-key:
    • mmwciqzxvozegg-xjtpdsdzsa-h
  • molecular-weight:
    • 414.049

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality