Difference between revisions of "L-THYROXINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00823 == * transcription-direction: ** positive * right-end-position: ** 431214 * left-end-position: ** 416517 * centisome-position: ** 74.52629...") |
(Created page with "Category:metabolite == Metabolite L-THYROXINE == * common-name: ** l-thyroxine * smiles: ** c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: **...") |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite L-THYROXINE == |
| − | * | + | * common-name: |
| − | ** | + | ** l-thyroxine |
| − | + | * smiles: | |
| − | + | ** c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) | |
| − | * | + | * inchi-key: |
| − | ** | + | ** xuiikfgfijcvmt-lbprgkrzsa-n |
| − | + | * molecular-weight: | |
| − | + | ** 776.874 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10606]] | |
| − | = | + | * [[RXN-10608]] |
| − | * | + | * [[RXN-10614]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=l-thyroxine}} |
| − | + | {{#set: inchi-key=inchikey=xuiikfgfijcvmt-lbprgkrzsa-n}} | |
| − | ** | + | {{#set: molecular-weight=776.874}} |
| − | * [[RXN- | ||
| − | * | ||
| − | * | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite L-THYROXINE
- common-name:
- l-thyroxine
- smiles:
- c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
- inchi-key:
- xuiikfgfijcvmt-lbprgkrzsa-n
- molecular-weight:
- 776.874
