Difference between revisions of "L-XYLULOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15837 == * common-name: ** β-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=cc=2c)o)c)))c)c)c * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite L-XYLULOSE == * common-name: ** l-xylulose * smiles: ** c(o)c(o)c(o)c(=o)co * inchi-key: ** zaqjhhrnxzubte-wvzvxsggsa-n * molecular-weigh...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-XYLULOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-xylulose |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c(o)c(o)c(=o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zaqjhhrnxzubte-wvzvxsggsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 150.131 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[L-XYLULOSE-REDUCTASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[L-XYLULOSE-REDUCTASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-xylulose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zaqjhhrnxzubte-wvzvxsggsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=150.131}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite L-XYLULOSE
- common-name:
- l-xylulose
- smiles:
- c(o)c(o)c(o)c(=o)co
- inchi-key:
- zaqjhhrnxzubte-wvzvxsggsa-n
- molecular-weight:
- 150.131
