Difference between revisions of "L-arabinopyranose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9918 RXN-9918] == * direction: ** reversible * common-name: ** carnitine o acetyltransferase *...")
(Created page with "Category:metabolite == Metabolite CPD-12015 == * common-name: ** 6-sulfatoxymelatonin * smiles: ** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2)) * inchi-key: ** qqe...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9918 RXN-9918] ==
+
== Metabolite CPD-12015 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** carnitine o acetyltransferase
+
** 6-sulfatoxymelatonin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.21 ec-2.3.1.21]
+
** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CARNITINE]][c] '''+''' 1 [[Long-Chain-Acyl-CoAs]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[O-Long-Chain-Acyl-L-Carnitines]][c]
+
** qqeilxdlzrltme-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11114]]
+
** 327.331
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ15882]]
+
* [[RXN-11058]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=6-sulfatoxymelatonin}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=qqeilxdlzrltme-uhfffaoysa-m}}
−
* [[PWY-6111]], mitochondrial L-carnitine shuttle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6111 PWY-6111]
+
{{#set: molecular-weight=327.331}}
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=carnitine o acetyltransferase}}
 
−
{{#set: ec-number=ec-2.3.1.21}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-12015

  • common-name:
    • 6-sulfatoxymelatonin
  • smiles:
    • cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2))
  • inchi-key:
    • qqeilxdlzrltme-uhfffaoysa-m
  • molecular-weight:
    • 327.331

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-arabinopyranose&oldid=47590"