Difference between revisions of "L-arabinopyranose"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12015 == * common-name: ** 6-sulfatoxymelatonin * smiles: ** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2)) * inchi-key: ** qqe...") |
(Created page with "Category:metabolite == Metabolite m7G5-pppm6Am-mRNAs == * common-name: ** a 5'-(n7-methyl 5'-triphosphoguanosine)-(n6,2'-o-dimethyladenosine)-[mrna] == Reaction(s) known t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite m7G5-pppm6Am-mRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5'-(n7-methyl 5'-triphosphoguanosine)-(n6,2'-o-dimethyladenosine)-[mrna] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.1.1.62-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5'-(n7-methyl 5'-triphosphoguanosine)-(n6,2'-o-dimethyladenosine)-[mrna]}} |
| − | |||
| − | |||
Revision as of 14:58, 5 January 2021
Contents
Metabolite m7G5-pppm6Am-mRNAs
- common-name:
- a 5'-(n7-methyl 5'-triphosphoguanosine)-(n6,2'-o-dimethyladenosine)-[mrna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5'-(n7-methyl 5'-triphosphoguanosine)-(n6,2'-o-dimethyladenosine)-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
