Difference between revisions of "L-arabinopyranose"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9918 RXN-9918] == * direction: ** reversible * common-name: ** carnitine o acetyltransferase *...") |
(Created page with "Category:metabolite == Metabolite CPD-12015 == * common-name: ** 6-sulfatoxymelatonin * smiles: ** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2)) * inchi-key: ** qqe...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12015 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 6-sulfatoxymelatonin |
− | * | + | * smiles: |
− | ** | + | ** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2)) |
− | == | + | * inchi-key: |
− | + | ** qqeilxdlzrltme-uhfffaoysa-m | |
− | == | + | * molecular-weight: |
− | * | + | ** 327.331 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-11058]] | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=6-sulfatoxymelatonin}} | |
− | == | + | {{#set: inchi-key=inchikey=qqeilxdlzrltme-uhfffaoysa-m}} |
− | + | {{#set: molecular-weight=327.331}} | |
− | |||
− | |||
− | * | ||
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:35, 18 December 2020
Contents
Metabolite CPD-12015
- common-name:
- 6-sulfatoxymelatonin
- smiles:
- cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2))
- inchi-key:
- qqeilxdlzrltme-uhfffaoysa-m
- molecular-weight:
- 327.331