Difference between revisions of "L-arginyl-3-sulfino-L-alaninyl-Peptides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TRYPTAMINE == * common-name: ** tryptamine * smiles: ** c([n+])cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** apjydqyyacxcrm-uhfffaoysa-o * molec...") |
(Created page with "Category:metabolite == Metabolite L-arginyl-3-sulfino-L-alaninyl-Peptides == * common-name: ** an n-terminal l-arginiyl-3-sulfino-l-alanyl-[protein] == Reaction(s) known t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-arginyl-3-sulfino-L-alaninyl-Peptides == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-terminal l-arginiyl-3-sulfino-l-alanyl-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17890]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-terminal l-arginiyl-3-sulfino-l-alanyl-[protein]}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite L-arginyl-3-sulfino-L-alaninyl-Peptides
- common-name:
- an n-terminal l-arginiyl-3-sulfino-l-alanyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal l-arginiyl-3-sulfino-l-alanyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
